About 4-[[(1S,2S)-2-(trifluoromethyl)cyclopropyl]methoxy]piperidine
4-[[(1S,2S)-2-(trifluoromethyl)cyclopropyl]methoxy]piperidine (PubChem CID 129298915) has the molecular formula C10H16F3NO
and a molecular weight of 223.24 g/mol. Its IUPAC name is 4-[[(1S,2S)-2-(trifluoromethyl)cyclopropyl]methoxy]piperidine.
Molecular Properties
| Compound Name | 4-[[(1S,2S)-2-(trifluoromethyl)cyclopropyl]methoxy]piperidine |
| PubChem CID | 129298915 |
| Molecular Formula | C10H16F3NO |
| Molecular Weight | 223.24 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 4-[[(1S,2S)-2-(trifluoromethyl)cyclopropyl]methoxy]piperidine |
| SMILES | FC(F)(F)[C@H]1C[C@@H]1COC1CCNCC1 |
| InChI | InChI=1S/C10H16F3NO/c11-10(12,13)9-5-7(9)6-15-8-1-3-14-4-2-8/h7-9,14H,1-6H2/t7-,9+/m1/s1 |
| InChIKey | GCUCIROCAPCZFK-APPZFPTMSA-N |
| XLogP | 1.95 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.24 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[[(1S,2S)-2-(trifluoromethyl)cyclopropyl]methoxy]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(1S,2S)-2-(trifluoromethyl)cyclopropyl]methoxy]piperidine?
The IUPAC name of 4-[[(1S,2S)-2-(trifluoromethyl)cyclopropyl]methoxy]piperidine (CID 129298915) is 4-[[(1S,2S)-2-(trifluoromethyl)cyclopropyl]methoxy]piperidine.
What is the SMILES notation for 4-[[(1S,2S)-2-(trifluoromethyl)cyclopropyl]methoxy]piperidine?
The canonical SMILES for 4-[[(1S,2S)-2-(trifluoromethyl)cyclopropyl]methoxy]piperidine is FC(F)(F)[C@H]1C[C@@H]1COC1CCNCC1.
What is the InChIKey of 4-[[(1S,2S)-2-(trifluoromethyl)cyclopropyl]methoxy]piperidine?
The InChIKey is GCUCIROCAPCZFK-APPZFPTMSA-N. The full InChI is InChI=1S/C10H16F3NO/c11-10(12,13)9-5-7(9)6-15-8-1-3-14-4-2-8/h7-9,14H,1-6H2/t7-,9+/m1/s1.
What are the key properties of 4-[[(1S,2S)-2-(trifluoromethyl)cyclopropyl]methoxy]piperidine?
4-[[(1S,2S)-2-(trifluoromethyl)cyclopropyl]methoxy]piperidine has a molecular weight of 223.24 g/mol, XLogP of 1.95, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(1S,2S)-2-(trifluoromethyl)cyclopropyl]methoxy]piperidine is sourced from PubChem (CID 129298915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).