About (3Z)-4-aminohexa-1,3,5-trien-3-ol
(3Z)-4-aminohexa-1,3,5-trien-3-ol (PubChem CID 129298921) has the molecular formula C6H9NO
and a molecular weight of 111.14 g/mol. Its IUPAC name is (3Z)-4-aminohexa-1,3,5-trien-3-ol.
Molecular Properties
| Compound Name | (3Z)-4-aminohexa-1,3,5-trien-3-ol |
| PubChem CID | 129298921 |
| Molecular Formula | C6H9NO |
| Molecular Weight | 111.14 g/mol |
| Exact Mass | 111.07 |
| IUPAC Name | (3Z)-4-aminohexa-1,3,5-trien-3-ol |
| SMILES | C=C/C(N)=C(/O)C=C |
| InChI | InChI=1S/C6H9NO/c1-3-5(7)6(8)4-2/h3-4,8H,1-2,7H2/b6-5- |
| InChIKey | SWAHVUQNPRXVEH-WAYWQWQTSA-N |
| XLogP | 1.09 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.14 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-4-aminohexa-1,3,5-trien-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-4-aminohexa-1,3,5-trien-3-ol?
The IUPAC name of (3Z)-4-aminohexa-1,3,5-trien-3-ol (CID 129298921) is (3Z)-4-aminohexa-1,3,5-trien-3-ol.
What is the SMILES notation for (3Z)-4-aminohexa-1,3,5-trien-3-ol?
The canonical SMILES for (3Z)-4-aminohexa-1,3,5-trien-3-ol is C=C/C(N)=C(/O)C=C.
What is the InChIKey of (3Z)-4-aminohexa-1,3,5-trien-3-ol?
The InChIKey is SWAHVUQNPRXVEH-WAYWQWQTSA-N. The full InChI is InChI=1S/C6H9NO/c1-3-5(7)6(8)4-2/h3-4,8H,1-2,7H2/b6-5-.
What are the key properties of (3Z)-4-aminohexa-1,3,5-trien-3-ol?
(3Z)-4-aminohexa-1,3,5-trien-3-ol has a molecular weight of 111.14 g/mol, XLogP of 1.09, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-4-aminohexa-1,3,5-trien-3-ol is sourced from PubChem (CID 129298921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).