C29H46O3 — CID 129299153
(3E,5Z)-6-ethenyl-9-[(3Z,4Z,6E)-3-ethylidene-6-[(2-methylpropan-2-yl)oxy]octa-4,6-dienoxy]-3-[(2-methylpropan-2-yl)oxy]nona-1,3,5-triene (PubChem CID 129299153) has the molecular formula C29H46O3 and a molecular weight of 442.68 g/mol. Its IUPAC name is (3E,5Z)-6-ethenyl-9-[(3Z,4Z,6E)-3-ethylidene-6-[(2-methylpropan-2-yl)oxy]octa-4,6-dienoxy]-3-[(2-methylpropan-2-yl)oxy]nona-1,3,5-triene.
| Compound Name | (3E,5Z)-6-ethenyl-9-[(3Z,4Z,6E)-3-ethylidene-6-[(2-methylpropan-2-yl)oxy]octa-4,6-dienoxy]-3-[(2-methylpropan-2-yl)oxy]nona-1,3,5-triene |
|---|---|
| PubChem CID | 129299153 |
| Molecular Formula | C29H46O3 |
| Molecular Weight | 442.68 g/mol |
| Exact Mass | 442.34 |
| IUPAC Name | (3E,5Z)-6-ethenyl-9-[(3Z,4Z,6E)-3-ethylidene-6-[(2-methylpropan-2-yl)oxy]octa-4,6-dienoxy]-3-[(2-methylpropan-2-yl)oxy]nona-1,3,5-triene |
| SMILES | C=C/C(=C\C=C(/C=C)OC(C)(C)C)CCCOCCC(/C=C\C(=C/C)OC(C)(C)C)=C/C |
| InChI | InChI=1S/C29H46O3/c1-11-24(17-19-26(13-3)31-28(5,6)7)16-15-22-30-23-21-25(12-2)18-20-27(14-4)32-29(8,9)10/h11-14,17-20H,1,3,15-16,21-23H2,2,4-10H3/b20-18-,24-17+,25-12+,26-19+,27-14+ |
| InChIKey | ZDYUSIWRBXVOEX-WZLLWCAJSA-N |
| XLogP | 8.39 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.68 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|