About 7-ethyl-2-methyl-3,4,5,6-tetrahydrodiazepine
7-ethyl-2-methyl-3,4,5,6-tetrahydrodiazepine (PubChem CID 129299212) has the molecular formula C8H16N2
and a molecular weight of 140.23 g/mol. Its IUPAC name is 7-ethyl-2-methyl-3,4,5,6-tetrahydrodiazepine.
Molecular Properties
| Compound Name | 7-ethyl-2-methyl-3,4,5,6-tetrahydrodiazepine |
| PubChem CID | 129299212 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | 7-ethyl-2-methyl-3,4,5,6-tetrahydrodiazepine |
| SMILES | CCC1=NN(C)CCCC1 |
| InChI | InChI=1S/C8H16N2/c1-3-8-6-4-5-7-10(2)9-8/h3-7H2,1-2H3 |
| InChIKey | OILFSSYEBHHKKC-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-ethyl-2-methyl-3,4,5,6-tetrahydrodiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethyl-2-methyl-3,4,5,6-tetrahydrodiazepine?
The IUPAC name of 7-ethyl-2-methyl-3,4,5,6-tetrahydrodiazepine (CID 129299212) is 7-ethyl-2-methyl-3,4,5,6-tetrahydrodiazepine.
What is the SMILES notation for 7-ethyl-2-methyl-3,4,5,6-tetrahydrodiazepine?
The canonical SMILES for 7-ethyl-2-methyl-3,4,5,6-tetrahydrodiazepine is CCC1=NN(C)CCCC1.
What is the InChIKey of 7-ethyl-2-methyl-3,4,5,6-tetrahydrodiazepine?
The InChIKey is OILFSSYEBHHKKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2/c1-3-8-6-4-5-7-10(2)9-8/h3-7H2,1-2H3.
What are the key properties of 7-ethyl-2-methyl-3,4,5,6-tetrahydrodiazepine?
7-ethyl-2-methyl-3,4,5,6-tetrahydrodiazepine has a molecular weight of 140.23 g/mol, XLogP of 1.87, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethyl-2-methyl-3,4,5,6-tetrahydrodiazepine is sourced from PubChem (CID 129299212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).