About 2,5-dimethyl-6-[4-[4-(trifluoromethoxy)phenoxy]phenyl]-1H-pyrazolo[1,5-a]pyrimidin-7-one
2,5-dimethyl-6-[4-[4-(trifluoromethoxy)phenoxy]phenyl]-1H-pyrazolo[1,5-a]pyrimidin-7-one (PubChem CID 129299580) has the molecular formula C21H16F3N3O3
and a molecular weight of 415.37 g/mol. Its IUPAC name is 2,5-dimethyl-6-[4-[4-(trifluoromethoxy)phenoxy]phenyl]-1H-pyrazolo[1,5-a]pyrimidin-7-one.
Molecular Properties
| Compound Name | 2,5-dimethyl-6-[4-[4-(trifluoromethoxy)phenoxy]phenyl]-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| PubChem CID | 129299580 |
| Molecular Formula | C21H16F3N3O3 |
| Molecular Weight | 415.37 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | 2,5-dimethyl-6-[4-[4-(trifluoromethoxy)phenoxy]phenyl]-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| SMILES | Cc1cc2nc(C)c(-c3ccc(Oc4ccc(OC(F)(F)F)cc4)cc3)c(=O)n2[nH]1 |
| InChI | InChI=1S/C21H16F3N3O3/c1-12-11-18-25-13(2)19(20(28)27(18)26-12)14-3-5-15(6-4-14)29-16-7-9-17(10-8-16)30-21(22,23)24/h3-11,26H,1-2H3 |
| InChIKey | NEHRNAGYDWSJJD-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.37 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2,5-dimethyl-6-[4-[4-(trifluoromethoxy)phenoxy]phenyl]-1H-pyrazolo[1,5-a]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-6-[4-[4-(trifluoromethoxy)phenoxy]phenyl]-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The IUPAC name of 2,5-dimethyl-6-[4-[4-(trifluoromethoxy)phenoxy]phenyl]-1H-pyrazolo[1,5-a]pyrimidin-7-one (CID 129299580) is 2,5-dimethyl-6-[4-[4-(trifluoromethoxy)phenoxy]phenyl]-1H-pyrazolo[1,5-a]pyrimidin-7-one.
What is the SMILES notation for 2,5-dimethyl-6-[4-[4-(trifluoromethoxy)phenoxy]phenyl]-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The canonical SMILES for 2,5-dimethyl-6-[4-[4-(trifluoromethoxy)phenoxy]phenyl]-1H-pyrazolo[1,5-a]pyrimidin-7-one is Cc1cc2nc(C)c(-c3ccc(Oc4ccc(OC(F)(F)F)cc4)cc3)c(=O)n2[nH]1.
What is the InChIKey of 2,5-dimethyl-6-[4-[4-(trifluoromethoxy)phenoxy]phenyl]-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The InChIKey is NEHRNAGYDWSJJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16F3N3O3/c1-12-11-18-25-13(2)19(20(28)27(18)26-12)14-3-5-15(6-4-14)29-16-7-9-17(10-8-16)30-21(22,23)24/h3-11,26H,1-2H3.
What are the key properties of 2,5-dimethyl-6-[4-[4-(trifluoromethoxy)phenoxy]phenyl]-1H-pyrazolo[1,5-a]pyrimidin-7-one?
2,5-dimethyl-6-[4-[4-(trifluoromethoxy)phenoxy]phenyl]-1H-pyrazolo[1,5-a]pyrimidin-7-one has a molecular weight of 415.37 g/mol, XLogP of 5.00, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-6-[4-[4-(trifluoromethoxy)phenoxy]phenyl]-1H-pyrazolo[1,5-a]pyrimidin-7-one is sourced from PubChem (CID 129299580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).