About (3E)-6-methyl-2-methylidene-3-prop-1-en-2-ylhepta-3,5-dienimidamide
(3E)-6-methyl-2-methylidene-3-prop-1-en-2-ylhepta-3,5-dienimidamide (PubChem CID 129299695) has the molecular formula C12H18N2
and a molecular weight of 190.29 g/mol. Its IUPAC name is (3E)-6-methyl-2-methylidene-3-prop-1-en-2-ylhepta-3,5-dienimidamide.
Molecular Properties
| Compound Name | (3E)-6-methyl-2-methylidene-3-prop-1-en-2-ylhepta-3,5-dienimidamide |
| PubChem CID | 129299695 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | (3E)-6-methyl-2-methylidene-3-prop-1-en-2-ylhepta-3,5-dienimidamide |
| SMILES | [H]/N=C(\N)C(=C)/C(=C/C=C(C)C)C(=C)C |
| InChI | InChI=1S/C12H18N2/c1-8(2)6-7-11(9(3)4)10(5)12(13)14/h6-7H,3,5H2,1-2,4H3,(H3,13,14)/b11-7+ |
| InChIKey | SHSHQELJLUGAFT-YRNVUSSQSA-N |
| XLogP | 2.95 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-6-methyl-2-methylidene-3-prop-1-en-2-ylhepta-3,5-dienimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-6-methyl-2-methylidene-3-prop-1-en-2-ylhepta-3,5-dienimidamide?
The IUPAC name of (3E)-6-methyl-2-methylidene-3-prop-1-en-2-ylhepta-3,5-dienimidamide (CID 129299695) is (3E)-6-methyl-2-methylidene-3-prop-1-en-2-ylhepta-3,5-dienimidamide.
What is the SMILES notation for (3E)-6-methyl-2-methylidene-3-prop-1-en-2-ylhepta-3,5-dienimidamide?
The canonical SMILES for (3E)-6-methyl-2-methylidene-3-prop-1-en-2-ylhepta-3,5-dienimidamide is [H]/N=C(\N)C(=C)/C(=C/C=C(C)C)C(=C)C.
What is the InChIKey of (3E)-6-methyl-2-methylidene-3-prop-1-en-2-ylhepta-3,5-dienimidamide?
The InChIKey is SHSHQELJLUGAFT-YRNVUSSQSA-N. The full InChI is InChI=1S/C12H18N2/c1-8(2)6-7-11(9(3)4)10(5)12(13)14/h6-7H,3,5H2,1-2,4H3,(H3,13,14)/b11-7+.
What are the key properties of (3E)-6-methyl-2-methylidene-3-prop-1-en-2-ylhepta-3,5-dienimidamide?
(3E)-6-methyl-2-methylidene-3-prop-1-en-2-ylhepta-3,5-dienimidamide has a molecular weight of 190.29 g/mol, XLogP of 2.95, 4 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-6-methyl-2-methylidene-3-prop-1-en-2-ylhepta-3,5-dienimidamide is sourced from PubChem (CID 129299695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).