About [(2S,4S,5R)-5-acetyloxy-4-fluorothiolan-2-yl]methyl (E)-3-phenylprop-2-enoate
[(2S,4S,5R)-5-acetyloxy-4-fluorothiolan-2-yl]methyl (E)-3-phenylprop-2-enoate (PubChem CID 129299731) has the molecular formula C16H17FO4S
and a molecular weight of 324.37 g/mol. Its IUPAC name is [(2S,4S,5R)-5-acetyloxy-4-fluorothiolan-2-yl]methyl (E)-3-phenylprop-2-enoate.
Molecular Properties
| Compound Name | [(2S,4S,5R)-5-acetyloxy-4-fluorothiolan-2-yl]methyl (E)-3-phenylprop-2-enoate |
| PubChem CID | 129299731 |
| Molecular Formula | C16H17FO4S |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | [(2S,4S,5R)-5-acetyloxy-4-fluorothiolan-2-yl]methyl (E)-3-phenylprop-2-enoate |
| SMILES | CC(=O)O[C@@H]1S[C@H](COC(=O)/C=C/c2ccccc2)C[C@@H]1F |
| InChI | InChI=1S/C16H17FO4S/c1-11(18)21-16-14(17)9-13(22-16)10-20-15(19)8-7-12-5-3-2-4-6-12/h2-8,13-14,16H,9-10H2,1H3/b8-7+/t13-,14-,16+/m0/s1 |
| InChIKey | DJHZWLIYBAIQLL-LERLDDTHSA-N |
| XLogP | 2.98 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [(2S,4S,5R)-5-acetyloxy-4-fluorothiolan-2-yl]methyl (E)-3-phenylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,4S,5R)-5-acetyloxy-4-fluorothiolan-2-yl]methyl (E)-3-phenylprop-2-enoate?
The IUPAC name of [(2S,4S,5R)-5-acetyloxy-4-fluorothiolan-2-yl]methyl (E)-3-phenylprop-2-enoate (CID 129299731) is [(2S,4S,5R)-5-acetyloxy-4-fluorothiolan-2-yl]methyl (E)-3-phenylprop-2-enoate.
What is the SMILES notation for [(2S,4S,5R)-5-acetyloxy-4-fluorothiolan-2-yl]methyl (E)-3-phenylprop-2-enoate?
The canonical SMILES for [(2S,4S,5R)-5-acetyloxy-4-fluorothiolan-2-yl]methyl (E)-3-phenylprop-2-enoate is CC(=O)O[C@@H]1S[C@H](COC(=O)/C=C/c2ccccc2)C[C@@H]1F.
What is the InChIKey of [(2S,4S,5R)-5-acetyloxy-4-fluorothiolan-2-yl]methyl (E)-3-phenylprop-2-enoate?
The InChIKey is DJHZWLIYBAIQLL-LERLDDTHSA-N. The full InChI is InChI=1S/C16H17FO4S/c1-11(18)21-16-14(17)9-13(22-16)10-20-15(19)8-7-12-5-3-2-4-6-12/h2-8,13-14,16H,9-10H2,1H3/b8-7+/t13-,14-,16+/m0/s1.
What are the key properties of [(2S,4S,5R)-5-acetyloxy-4-fluorothiolan-2-yl]methyl (E)-3-phenylprop-2-enoate?
[(2S,4S,5R)-5-acetyloxy-4-fluorothiolan-2-yl]methyl (E)-3-phenylprop-2-enoate has a molecular weight of 324.37 g/mol, XLogP of 2.98, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,4S,5R)-5-acetyloxy-4-fluorothiolan-2-yl]methyl (E)-3-phenylprop-2-enoate is sourced from PubChem (CID 129299731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).