About [(2R,3S,5R)-5-acetyloxy-2-(benzotriazol-1-yloxymethyl)thiolan-3-yl] benzoate
[(2R,3S,5R)-5-acetyloxy-2-(benzotriazol-1-yloxymethyl)thiolan-3-yl] benzoate (PubChem CID 129300017) has the molecular formula C20H19N3O5S
and a molecular weight of 413.46 g/mol. Its IUPAC name is [(2R,3S,5R)-5-acetyloxy-2-(benzotriazol-1-yloxymethyl)thiolan-3-yl] benzoate.
Molecular Properties
| Compound Name | [(2R,3S,5R)-5-acetyloxy-2-(benzotriazol-1-yloxymethyl)thiolan-3-yl] benzoate |
| PubChem CID | 129300017 |
| Molecular Formula | C20H19N3O5S |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | [(2R,3S,5R)-5-acetyloxy-2-(benzotriazol-1-yloxymethyl)thiolan-3-yl] benzoate |
| SMILES | CC(=O)O[C@H]1C[C@H](OC(=O)c2ccccc2)[C@@H](COn2nnc3ccccc32)S1 |
| InChI | InChI=1S/C20H19N3O5S/c1-13(24)27-19-11-17(28-20(25)14-7-3-2-4-8-14)18(29-19)12-26-23-16-10-6-5-9-15(16)21-22-23/h2-10,17-19H,11-12H2,1H3/t17-,18+,19+/m0/s1 |
| InChIKey | UJSYDBGRXZXXJB-IPMKNSEASA-N |
| XLogP | 2.48 |
| TPSA | 92.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze [(2R,3S,5R)-5-acetyloxy-2-(benzotriazol-1-yloxymethyl)thiolan-3-yl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,3S,5R)-5-acetyloxy-2-(benzotriazol-1-yloxymethyl)thiolan-3-yl] benzoate?
The IUPAC name of [(2R,3S,5R)-5-acetyloxy-2-(benzotriazol-1-yloxymethyl)thiolan-3-yl] benzoate (CID 129300017) is [(2R,3S,5R)-5-acetyloxy-2-(benzotriazol-1-yloxymethyl)thiolan-3-yl] benzoate.
What is the SMILES notation for [(2R,3S,5R)-5-acetyloxy-2-(benzotriazol-1-yloxymethyl)thiolan-3-yl] benzoate?
The canonical SMILES for [(2R,3S,5R)-5-acetyloxy-2-(benzotriazol-1-yloxymethyl)thiolan-3-yl] benzoate is CC(=O)O[C@H]1C[C@H](OC(=O)c2ccccc2)[C@@H](COn2nnc3ccccc32)S1.
What is the InChIKey of [(2R,3S,5R)-5-acetyloxy-2-(benzotriazol-1-yloxymethyl)thiolan-3-yl] benzoate?
The InChIKey is UJSYDBGRXZXXJB-IPMKNSEASA-N. The full InChI is InChI=1S/C20H19N3O5S/c1-13(24)27-19-11-17(28-20(25)14-7-3-2-4-8-14)18(29-19)12-26-23-16-10-6-5-9-15(16)21-22-23/h2-10,17-19H,11-12H2,1H3/t17-,18+,19+/m0/s1.
What are the key properties of [(2R,3S,5R)-5-acetyloxy-2-(benzotriazol-1-yloxymethyl)thiolan-3-yl] benzoate?
[(2R,3S,5R)-5-acetyloxy-2-(benzotriazol-1-yloxymethyl)thiolan-3-yl] benzoate has a molecular weight of 413.46 g/mol, XLogP of 2.48, 6 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,3S,5R)-5-acetyloxy-2-(benzotriazol-1-yloxymethyl)thiolan-3-yl] benzoate is sourced from PubChem (CID 129300017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).