C5H9FINO2 — CID 129300060
(2R,3S,4R)-4-fluoro-5-imino-3-iodopentane-1,2-diol (PubChem CID 129300060) has the molecular formula C5H9FINO2 and a molecular weight of 261.03 g/mol. Its IUPAC name is (2R,3S,4R)-4-fluoro-5-imino-3-iodopentane-1,2-diol.
| Compound Name | (2R,3S,4R)-4-fluoro-5-imino-3-iodopentane-1,2-diol |
|---|---|
| PubChem CID | 129300060 |
| Molecular Formula | C5H9FINO2 |
| Molecular Weight | 261.03 g/mol |
| Exact Mass | 260.97 |
| IUPAC Name | (2R,3S,4R)-4-fluoro-5-imino-3-iodopentane-1,2-diol |
| SMILES | [H]/N=C/[C@@H](F)[C@@H](I)[C@H](O)CO |
| InChI | InChI=1S/C5H9FINO2/c6-3(1-8)5(7)4(10)2-9/h1,3-5,8-10H,2H2/b8-1+/t3-,4-,5-/m1/s1 |
| InChIKey | LWGIDOWNKLJTEQ-NHBARTOGSA-N |
| XLogP | 0.13 |
| TPSA | 64.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.03 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|