C24H31F2N5O — CID 129300235
N-cyclopropyl-3-(4,4-difluoropentylamino)-2-(methyliminomethyl)-N-(4,5,6,7-tetrahydro-1H-indazol-5-yl)benzamide (PubChem CID 129300235) has the molecular formula C24H31F2N5O and a molecular weight of 443.54 g/mol. Its IUPAC name is N-cyclopropyl-3-(4,4-difluoropentylamino)-2-(methyliminomethyl)-N-(4,5,6,7-tetrahydro-1H-indazol-5-yl)benzamide.
| Compound Name | N-cyclopropyl-3-(4,4-difluoropentylamino)-2-(methyliminomethyl)-N-(4,5,6,7-tetrahydro-1H-indazol-5-yl)benzamide |
|---|---|
| PubChem CID | 129300235 |
| Molecular Formula | C24H31F2N5O |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | N-cyclopropyl-3-(4,4-difluoropentylamino)-2-(methyliminomethyl)-N-(4,5,6,7-tetrahydro-1H-indazol-5-yl)benzamide |
| SMILES | C/N=C/c1c(NCCCC(C)(F)F)cccc1C(=O)N(C1CC1)C1CCc2[nH]ncc2C1 |
| InChI | InChI=1S/C24H31F2N5O/c1-24(25,26)11-4-12-28-22-6-3-5-19(20(22)15-27-2)23(32)31(17-7-8-17)18-9-10-21-16(13-18)14-29-30-21/h3,5-6,14-15,17-18,28H,4,7-13H2,1-2H3,(H,29,30)/b27-15+ |
| InChIKey | CPHCGWHMQKHHIG-JFLMPSFJSA-N |
| XLogP | 4.47 |
| TPSA | 73.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|