C22H23Cl2N3O2 — CID 129300790
N-cyclopropyl-5-(5,6-dichloro-5-methylcyclohexa-1,3-dien-1-yl)-N-(4,5,6,7-tetrahydro-1H-indazol-5-yl)furan-2-carboxamide (PubChem CID 129300790) has the molecular formula C22H23Cl2N3O2 and a molecular weight of 432.35 g/mol. Its IUPAC name is N-cyclopropyl-5-(5,6-dichloro-5-methylcyclohexa-1,3-dien-1-yl)-N-(4,5,6,7-tetrahydro-1H-indazol-5-yl)furan-2-carboxamide.
| Compound Name | N-cyclopropyl-5-(5,6-dichloro-5-methylcyclohexa-1,3-dien-1-yl)-N-(4,5,6,7-tetrahydro-1H-indazol-5-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 129300790 |
| Molecular Formula | C22H23Cl2N3O2 |
| Molecular Weight | 432.35 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | N-cyclopropyl-5-(5,6-dichloro-5-methylcyclohexa-1,3-dien-1-yl)-N-(4,5,6,7-tetrahydro-1H-indazol-5-yl)furan-2-carboxamide |
| SMILES | CC1(Cl)C=CC=C(c2ccc(C(=O)N(C3CC3)C3CCc4[nH]ncc4C3)o2)C1Cl |
| InChI | InChI=1S/C22H23Cl2N3O2/c1-22(24)10-2-3-16(20(22)23)18-8-9-19(29-18)21(28)27(14-4-5-14)15-6-7-17-13(11-15)12-25-26-17/h2-3,8-10,12,14-15,20H,4-7,11H2,1H3,(H,25,26) |
| InChIKey | QNPAUGUVGCGCLN-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.35 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|