C23H27N3O3 — CID 129300805
4-(cyclobutylmethoxy)-N-cyclopropyl-N-(2-formyl-4,5,6,7-tetrahydroindazol-5-yl)benzamide (PubChem CID 129300805) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is 4-(cyclobutylmethoxy)-N-cyclopropyl-N-(2-formyl-4,5,6,7-tetrahydroindazol-5-yl)benzamide.
| Compound Name | 4-(cyclobutylmethoxy)-N-cyclopropyl-N-(2-formyl-4,5,6,7-tetrahydroindazol-5-yl)benzamide |
|---|---|
| PubChem CID | 129300805 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | 4-(cyclobutylmethoxy)-N-cyclopropyl-N-(2-formyl-4,5,6,7-tetrahydroindazol-5-yl)benzamide |
| SMILES | O=Cn1cc2c(n1)CCC(N(C(=O)c1ccc(OCC3CCC3)cc1)C1CC1)C2 |
| InChI | InChI=1S/C23H27N3O3/c27-15-25-13-18-12-20(8-11-22(18)24-25)26(19-6-7-19)23(28)17-4-9-21(10-5-17)29-14-16-2-1-3-16/h4-5,9-10,13,15-16,19-20H,1-3,6-8,11-12,14H2 |
| InChIKey | LUJRFHCQRVZOTK-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|