C29H35N17O3 — CID 129300813
(1-azido-2-methylpropan-2-yl) 5-[[1-[4-azido-3,3-bis(azidomethyl)butyl]indazole-4-carbonyl]-cyclopropylamino]-4,5,6,7-tetrahydroindazole-2-carboxylate (PubChem CID 129300813) has the molecular formula C29H35N17O3 and a molecular weight of 669.72 g/mol. Its IUPAC name is (1-azido-2-methylpropan-2-yl) 5-[[1-[4-azido-3,3-bis(azidomethyl)butyl]indazole-4-carbonyl]-cyclopropylamino]-4,5,6,7-tetrahydroindazole-2-carboxylate.
| Compound Name | (1-azido-2-methylpropan-2-yl) 5-[[1-[4-azido-3,3-bis(azidomethyl)butyl]indazole-4-carbonyl]-cyclopropylamino]-4,5,6,7-tetrahydroindazole-2-carboxylate |
|---|---|
| PubChem CID | 129300813 |
| Molecular Formula | C29H35N17O3 |
| Molecular Weight | 669.72 g/mol |
| Exact Mass | 669.31 |
| IUPAC Name | (1-azido-2-methylpropan-2-yl) 5-[[1-[4-azido-3,3-bis(azidomethyl)butyl]indazole-4-carbonyl]-cyclopropylamino]-4,5,6,7-tetrahydroindazole-2-carboxylate |
| SMILES | CC(C)(CN=[N+]=[N-])OC(=O)n1cc2c(n1)CCC(N(C(=O)c1cccc3c1cnn3CCC(CN=[N+]=[N-])(CN=[N+]=[N-])CN=[N+]=[N-])C1CC1)C2 |
| InChI | InChI=1S/C29H35N17O3/c1-28(2,15-34-40-30)49-27(48)45-14-19-12-21(8-9-24(19)39-45)46(20-6-7-20)26(47)22-4-3-5-25-23(22)13-38-44(25)11-10-29(16-35-41-31,17-36-42-32)18-37-43-33/h3-5,13-14,20-21H,6-12,15-18H2,1-2H3 |
| InChIKey | NIMZTHPCUJXUTC-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 277.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.72 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|