About 1,7-dimethyl-1,3,5-triazepine
1,7-dimethyl-1,3,5-triazepine (PubChem CID 129300917) has the molecular formula C6H9N3
and a molecular weight of 123.16 g/mol. Its IUPAC name is 1,7-dimethyl-1,3,5-triazepine.
Molecular Properties
| Compound Name | 1,7-dimethyl-1,3,5-triazepine |
| PubChem CID | 129300917 |
| Molecular Formula | C6H9N3 |
| Molecular Weight | 123.16 g/mol |
| Exact Mass | 123.08 |
| IUPAC Name | 1,7-dimethyl-1,3,5-triazepine |
| SMILES | CC1=CN=CN=CN1C |
| InChI | InChI=1S/C6H9N3/c1-6-3-7-4-8-5-9(6)2/h3-5H,1-2H3 |
| InChIKey | CBIWYSYAKVOWKX-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.16 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,7-dimethyl-1,3,5-triazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,7-dimethyl-1,3,5-triazepine?
The IUPAC name of 1,7-dimethyl-1,3,5-triazepine (CID 129300917) is 1,7-dimethyl-1,3,5-triazepine.
What is the SMILES notation for 1,7-dimethyl-1,3,5-triazepine?
The canonical SMILES for 1,7-dimethyl-1,3,5-triazepine is CC1=CN=CN=CN1C.
What is the InChIKey of 1,7-dimethyl-1,3,5-triazepine?
The InChIKey is CBIWYSYAKVOWKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3/c1-6-3-7-4-8-5-9(6)2/h3-5H,1-2H3.
What are the key properties of 1,7-dimethyl-1,3,5-triazepine?
1,7-dimethyl-1,3,5-triazepine has a molecular weight of 123.16 g/mol, XLogP of 0.85, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,7-dimethyl-1,3,5-triazepine is sourced from PubChem (CID 129300917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).