C20H31N3 — CID 129300941
(5E,6Z)-5-ethylidene-N',4-dimethyl-N-[1-(3-methylbut-3-enylamino)ethenyl]nona-2,6,8-trienimidamide (PubChem CID 129300941) has the molecular formula C20H31N3 and a molecular weight of 313.49 g/mol. Its IUPAC name is (5E,6Z)-5-ethylidene-N',4-dimethyl-N-[1-(3-methylbut-3-enylamino)ethenyl]nona-2,6,8-trienimidamide.
| Compound Name | (5E,6Z)-5-ethylidene-N',4-dimethyl-N-[1-(3-methylbut-3-enylamino)ethenyl]nona-2,6,8-trienimidamide |
|---|---|
| PubChem CID | 129300941 |
| Molecular Formula | C20H31N3 |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.25 |
| IUPAC Name | (5E,6Z)-5-ethylidene-N',4-dimethyl-N-[1-(3-methylbut-3-enylamino)ethenyl]nona-2,6,8-trienimidamide |
| SMILES | C=C/C=C\C(=C/C)C(C)C=C/C(=N/C)NC(=C)NCCC(=C)C |
| InChI | InChI=1S/C20H31N3/c1-8-10-11-19(9-2)17(5)12-13-20(21-7)23-18(6)22-15-14-16(3)4/h8-13,17,22H,1,3,6,14-15H2,2,4-5,7H3,(H,21,23)/b11-10-,13-12?,19-9+ |
| InChIKey | SENHDSFUKPWABO-RJCLIFKFSA-N |
| XLogP | 4.51 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|