C12H19N5O4 — CID 129302092
(2R,3R,4R)-4-(2,4-diaminopyrrolo[2,3-d]pyrimidin-7-yl)-2-methoxypentane-1,3,4-triol (PubChem CID 129302092) has the molecular formula C12H19N5O4 and a molecular weight of 297.32 g/mol. Its IUPAC name is (2R,3R,4R)-4-(2,4-diaminopyrrolo[2,3-d]pyrimidin-7-yl)-2-methoxypentane-1,3,4-triol.
| Compound Name | (2R,3R,4R)-4-(2,4-diaminopyrrolo[2,3-d]pyrimidin-7-yl)-2-methoxypentane-1,3,4-triol |
|---|---|
| PubChem CID | 129302092 |
| Molecular Formula | C12H19N5O4 |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | (2R,3R,4R)-4-(2,4-diaminopyrrolo[2,3-d]pyrimidin-7-yl)-2-methoxypentane-1,3,4-triol |
| SMILES | CO[C@H](CO)[C@@H](O)[C@@](C)(O)n1ccc2c(N)nc(N)nc21 |
| InChI | InChI=1S/C12H19N5O4/c1-12(20,8(19)7(5-18)21-2)17-4-3-6-9(13)15-11(14)16-10(6)17/h3-4,7-8,18-20H,5H2,1-2H3,(H4,13,14,15,16)/t7-,8-,12-/m1/s1 |
| InChIKey | YEJMYFOCXGKSLL-DNSOKLHBSA-N |
| XLogP | -1.37 |
| TPSA | 152.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |