About trans-(2S,6S)-2,6-bis(naphthalen-2-ylmethyl)cyclohexan-1-one
trans-(2S,6S)-2,6-bis(naphthalen-2-ylmethyl)cyclohexan-1-one (PubChem CID 129302121) has the molecular formula C28H26O
and a molecular weight of 378.52 g/mol. Its IUPAC name is trans-(2S,6S)-2,6-bis(naphthalen-2-ylmethyl)cyclohexan-1-one.
Molecular Properties
| Compound Name | trans-(2S,6S)-2,6-bis(naphthalen-2-ylmethyl)cyclohexan-1-one |
| PubChem CID | 129302121 |
| Molecular Formula | C28H26O |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | trans-(2S,6S)-2,6-bis(naphthalen-2-ylmethyl)cyclohexan-1-one |
| SMILES | O=C1[C@H](Cc2ccc3ccccc3c2)CCC[C@H]1Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C28H26O/c29-28-26(18-20-12-14-22-6-1-3-8-24(22)16-20)10-5-11-27(28)19-21-13-15-23-7-2-4-9-25(23)17-21/h1-4,6-9,12-17,26-27H,5,10-11,18-19H2/t26-,27-/m0/s1 |
| InChIKey | PEUBAAPXFSBWPO-SVBPBHIXSA-N |
| XLogP | 6.76 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze trans-(2S,6S)-2,6-bis(naphthalen-2-ylmethyl)cyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(2S,6S)-2,6-bis(naphthalen-2-ylmethyl)cyclohexan-1-one?
The IUPAC name of trans-(2S,6S)-2,6-bis(naphthalen-2-ylmethyl)cyclohexan-1-one (CID 129302121) is trans-(2S,6S)-2,6-bis(naphthalen-2-ylmethyl)cyclohexan-1-one.
What is the SMILES notation for trans-(2S,6S)-2,6-bis(naphthalen-2-ylmethyl)cyclohexan-1-one?
The canonical SMILES for trans-(2S,6S)-2,6-bis(naphthalen-2-ylmethyl)cyclohexan-1-one is O=C1[C@H](Cc2ccc3ccccc3c2)CCC[C@H]1Cc1ccc2ccccc2c1.
What is the InChIKey of trans-(2S,6S)-2,6-bis(naphthalen-2-ylmethyl)cyclohexan-1-one?
The InChIKey is PEUBAAPXFSBWPO-SVBPBHIXSA-N. The full InChI is InChI=1S/C28H26O/c29-28-26(18-20-12-14-22-6-1-3-8-24(22)16-20)10-5-11-27(28)19-21-13-15-23-7-2-4-9-25(23)17-21/h1-4,6-9,12-17,26-27H,5,10-11,18-19H2/t26-,27-/m0/s1.
What are the key properties of trans-(2S,6S)-2,6-bis(naphthalen-2-ylmethyl)cyclohexan-1-one?
trans-(2S,6S)-2,6-bis(naphthalen-2-ylmethyl)cyclohexan-1-one has a molecular weight of 378.52 g/mol, XLogP of 6.76, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(2S,6S)-2,6-bis(naphthalen-2-ylmethyl)cyclohexan-1-one is sourced from PubChem (CID 129302121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).