C55H40N2 — CID 129302327
(2Z)-1-[6-[6-(9,9-diphenylfluoren-2-yl)naphthalen-2-yl]-4-phenyl-1,2-dihydroquinolin-2-yl]penta-2,4-dien-1-imine (PubChem CID 129302327) has the molecular formula C55H40N2 and a molecular weight of 728.94 g/mol. Its IUPAC name is (2Z)-1-[6-[6-(9,9-diphenylfluoren-2-yl)naphthalen-2-yl]-4-phenyl-1,2-dihydroquinolin-2-yl]penta-2,4-dien-1-imine.
| Compound Name | (2Z)-1-[6-[6-(9,9-diphenylfluoren-2-yl)naphthalen-2-yl]-4-phenyl-1,2-dihydroquinolin-2-yl]penta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 129302327 |
| Molecular Formula | C55H40N2 |
| Molecular Weight | 728.94 g/mol |
| Exact Mass | 728.32 |
| IUPAC Name | (2Z)-1-[6-[6-(9,9-diphenylfluoren-2-yl)naphthalen-2-yl]-4-phenyl-1,2-dihydroquinolin-2-yl]penta-2,4-dien-1-imine |
| SMILES | [H]/N=C(\C=C/C=C)C1C=C(c2ccccc2)c2cc(-c3ccc4cc(-c5ccc6c(c5)C(c5ccccc5)(c5ccccc5)c5ccccc5-6)ccc4c3)ccc2N1 |
| InChI | InChI=1S/C55H40N2/c1-2-3-23-52(56)54-36-48(37-15-7-4-8-16-37)49-34-42(29-31-53(49)57-54)40-26-24-39-33-41(27-25-38(39)32-40)43-28-30-47-46-21-13-14-22-50(46)55(51(47)35-43,44-17-9-5-10-18-44)45-19-11-6-12-20-45/h2-36,54,56-57H,1H2/b23-3-,56-52+ |
| InChIKey | NWAZWXDGPJQHNJ-GXAPCDRUSA-N |
| XLogP | 13.52 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.94 |
| LogP ≤ 5 | 13.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|