About 2-(5-fluoro-2-imino-1-pyridinyl)-2-imino-N,N-dimethylethanamine
2-(5-fluoro-2-imino-1-pyridinyl)-2-imino-N,N-dimethylethanamine (PubChem CID 129302384) has the molecular formula C9H13FN4
and a molecular weight of 196.23 g/mol. Its IUPAC name is 2-(5-fluoro-2-imino-1-pyridinyl)-2-imino-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 2-(5-fluoro-2-imino-1-pyridinyl)-2-imino-N,N-dimethylethanamine |
| PubChem CID | 129302384 |
| Molecular Formula | C9H13FN4 |
| Molecular Weight | 196.23 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 2-(5-fluoro-2-imino-1-pyridinyl)-2-imino-N,N-dimethylethanamine |
| SMILES | [H]/N=C(\CN(C)C)n1cc(F)cc/c1=N\[H] |
| InChI | InChI=1S/C9H13FN4/c1-13(2)6-9(12)14-5-7(10)3-4-8(14)11/h3-5,11-12H,6H2,1-2H3/b11-8+,12-9+ |
| InChIKey | NIVUGLIQPCNTRG-HZOWPXDZSA-N |
| XLogP | 0.49 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.23 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-fluoro-2-imino-1-pyridinyl)-2-imino-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-fluoro-2-imino-1-pyridinyl)-2-imino-N,N-dimethylethanamine?
The IUPAC name of 2-(5-fluoro-2-imino-1-pyridinyl)-2-imino-N,N-dimethylethanamine (CID 129302384) is 2-(5-fluoro-2-imino-1-pyridinyl)-2-imino-N,N-dimethylethanamine.
What is the SMILES notation for 2-(5-fluoro-2-imino-1-pyridinyl)-2-imino-N,N-dimethylethanamine?
The canonical SMILES for 2-(5-fluoro-2-imino-1-pyridinyl)-2-imino-N,N-dimethylethanamine is [H]/N=C(\CN(C)C)n1cc(F)cc/c1=N\[H].
What is the InChIKey of 2-(5-fluoro-2-imino-1-pyridinyl)-2-imino-N,N-dimethylethanamine?
The InChIKey is NIVUGLIQPCNTRG-HZOWPXDZSA-N. The full InChI is InChI=1S/C9H13FN4/c1-13(2)6-9(12)14-5-7(10)3-4-8(14)11/h3-5,11-12H,6H2,1-2H3/b11-8+,12-9+.
What are the key properties of 2-(5-fluoro-2-imino-1-pyridinyl)-2-imino-N,N-dimethylethanamine?
2-(5-fluoro-2-imino-1-pyridinyl)-2-imino-N,N-dimethylethanamine has a molecular weight of 196.23 g/mol, XLogP of 0.49, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-fluoro-2-imino-1-pyridinyl)-2-imino-N,N-dimethylethanamine is sourced from PubChem (CID 129302384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).