C17H32S — CID 129302700
2-(6-ethyl-3,3,4,8-tetramethylnon-7-en-2-yl)thiirane (PubChem CID 129302700) has the molecular formula C17H32S and a molecular weight of 268.51 g/mol. Its IUPAC name is 2-(6-ethyl-3,3,4,8-tetramethylnon-7-en-2-yl)thiirane.
| Compound Name | 2-(6-ethyl-3,3,4,8-tetramethylnon-7-en-2-yl)thiirane |
|---|---|
| PubChem CID | 129302700 |
| Molecular Formula | C17H32S |
| Molecular Weight | 268.51 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | 2-(6-ethyl-3,3,4,8-tetramethylnon-7-en-2-yl)thiirane |
| SMILES | CCC(C=C(C)C)CC(C)C(C)(C)C(C)C1CS1 |
| InChI | InChI=1S/C17H32S/c1-8-15(9-12(2)3)10-13(4)17(6,7)14(5)16-11-18-16/h9,13-16H,8,10-11H2,1-7H3 |
| InChIKey | PZBIHGQQBNAAOC-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.51 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|