About 3-bromo-N-[2-(1,10-phenanthrolin-5-yl)phenyl]benzamide
3-bromo-N-[2-(1,10-phenanthrolin-5-yl)phenyl]benzamide (PubChem CID 129303539) has the molecular formula C25H16BrN3O
and a molecular weight of 454.33 g/mol. Its IUPAC name is 3-bromo-N-[2-(1,10-phenanthrolin-5-yl)phenyl]benzamide.
Molecular Properties
| Compound Name | 3-bromo-N-[2-(1,10-phenanthrolin-5-yl)phenyl]benzamide |
| PubChem CID | 129303539 |
| Molecular Formula | C25H16BrN3O |
| Molecular Weight | 454.33 g/mol |
| Exact Mass | 453.05 |
| IUPAC Name | 3-bromo-N-[2-(1,10-phenanthrolin-5-yl)phenyl]benzamide |
| SMILES | O=C(Nc1ccccc1-c1cc2cccnc2c2ncccc12)c1cccc(Br)c1 |
| InChI | InChI=1S/C25H16BrN3O/c26-18-8-3-6-17(14-18)25(30)29-22-11-2-1-9-19(22)21-15-16-7-4-12-27-23(16)24-20(21)10-5-13-28-24/h1-15H,(H,29,30) |
| InChIKey | YHEVYBAWXUBAGD-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 454.33 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-N-[2-(1,10-phenanthrolin-5-yl)phenyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-N-[2-(1,10-phenanthrolin-5-yl)phenyl]benzamide?
The IUPAC name of 3-bromo-N-[2-(1,10-phenanthrolin-5-yl)phenyl]benzamide (CID 129303539) is 3-bromo-N-[2-(1,10-phenanthrolin-5-yl)phenyl]benzamide.
What is the SMILES notation for 3-bromo-N-[2-(1,10-phenanthrolin-5-yl)phenyl]benzamide?
The canonical SMILES for 3-bromo-N-[2-(1,10-phenanthrolin-5-yl)phenyl]benzamide is O=C(Nc1ccccc1-c1cc2cccnc2c2ncccc12)c1cccc(Br)c1.
What is the InChIKey of 3-bromo-N-[2-(1,10-phenanthrolin-5-yl)phenyl]benzamide?
The InChIKey is YHEVYBAWXUBAGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H16BrN3O/c26-18-8-3-6-17(14-18)25(30)29-22-11-2-1-9-19(22)21-15-16-7-4-12-27-23(16)24-20(21)10-5-13-28-24/h1-15H,(H,29,30).
What are the key properties of 3-bromo-N-[2-(1,10-phenanthrolin-5-yl)phenyl]benzamide?
3-bromo-N-[2-(1,10-phenanthrolin-5-yl)phenyl]benzamide has a molecular weight of 454.33 g/mol, XLogP of 6.46, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-N-[2-(1,10-phenanthrolin-5-yl)phenyl]benzamide is sourced from PubChem (CID 129303539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).