About 3-[2-(2,3-dicarboxy-4-hydroxyphenyl)propan-2-yl]-6-hydroxyphthalic acid
3-[2-(2,3-dicarboxy-4-hydroxyphenyl)propan-2-yl]-6-hydroxyphthalic acid (PubChem CID 129303917) has the molecular formula C19H16O10
and a molecular weight of 404.33 g/mol. Its IUPAC name is 3-[2-(2,3-dicarboxy-4-hydroxyphenyl)propan-2-yl]-6-hydroxyphthalic acid.
Molecular Properties
| Compound Name | 3-[2-(2,3-dicarboxy-4-hydroxyphenyl)propan-2-yl]-6-hydroxyphthalic acid |
| PubChem CID | 129303917 |
| Molecular Formula | C19H16O10 |
| Molecular Weight | 404.33 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | 3-[2-(2,3-dicarboxy-4-hydroxyphenyl)propan-2-yl]-6-hydroxyphthalic acid |
| SMILES | CC(C)(c1ccc(O)c(C(=O)O)c1C(=O)O)c1ccc(O)c(C(=O)O)c1C(=O)O |
| InChI | InChI=1S/C19H16O10/c1-19(2,7-3-5-9(20)13(17(26)27)11(7)15(22)23)8-4-6-10(21)14(18(28)29)12(8)16(24)25/h3-6,20-21H,1-2H3,(H,22,23)(H,24,25)(H,26,27)(H,28,29) |
| InChIKey | FBPPRGFURRTKAT-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 189.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 404.33 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[2-(2,3-dicarboxy-4-hydroxyphenyl)propan-2-yl]-6-hydroxyphthalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(2,3-dicarboxy-4-hydroxyphenyl)propan-2-yl]-6-hydroxyphthalic acid?
The IUPAC name of 3-[2-(2,3-dicarboxy-4-hydroxyphenyl)propan-2-yl]-6-hydroxyphthalic acid (CID 129303917) is 3-[2-(2,3-dicarboxy-4-hydroxyphenyl)propan-2-yl]-6-hydroxyphthalic acid.
What is the SMILES notation for 3-[2-(2,3-dicarboxy-4-hydroxyphenyl)propan-2-yl]-6-hydroxyphthalic acid?
The canonical SMILES for 3-[2-(2,3-dicarboxy-4-hydroxyphenyl)propan-2-yl]-6-hydroxyphthalic acid is CC(C)(c1ccc(O)c(C(=O)O)c1C(=O)O)c1ccc(O)c(C(=O)O)c1C(=O)O.
What is the InChIKey of 3-[2-(2,3-dicarboxy-4-hydroxyphenyl)propan-2-yl]-6-hydroxyphthalic acid?
The InChIKey is FBPPRGFURRTKAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16O10/c1-19(2,7-3-5-9(20)13(17(26)27)11(7)15(22)23)8-4-6-10(21)14(18(28)29)12(8)16(24)25/h3-6,20-21H,1-2H3,(H,22,23)(H,24,25)(H,26,27)(H,28,29).
What are the key properties of 3-[2-(2,3-dicarboxy-4-hydroxyphenyl)propan-2-yl]-6-hydroxyphthalic acid?
3-[2-(2,3-dicarboxy-4-hydroxyphenyl)propan-2-yl]-6-hydroxyphthalic acid has a molecular weight of 404.33 g/mol, XLogP of 2.22, 6 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(2,3-dicarboxy-4-hydroxyphenyl)propan-2-yl]-6-hydroxyphthalic acid is sourced from PubChem (CID 129303917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).