About 2-[(4-aminocyclohexa-2,4-dien-1-yl)-(2-hydroxyethyl)amino]ethanol
2-[(4-aminocyclohexa-2,4-dien-1-yl)-(2-hydroxyethyl)amino]ethanol (PubChem CID 129303960) has the molecular formula C10H18N2O2
and a molecular weight of 198.27 g/mol. Its IUPAC name is 2-[(4-aminocyclohexa-2,4-dien-1-yl)-(2-hydroxyethyl)amino]ethanol.
Molecular Properties
| Compound Name | 2-[(4-aminocyclohexa-2,4-dien-1-yl)-(2-hydroxyethyl)amino]ethanol |
| PubChem CID | 129303960 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 2-[(4-aminocyclohexa-2,4-dien-1-yl)-(2-hydroxyethyl)amino]ethanol |
| SMILES | NC1=CCC(N(CCO)CCO)C=C1 |
| InChI | InChI=1S/C10H18N2O2/c11-9-1-3-10(4-2-9)12(5-7-13)6-8-14/h1-3,10,13-14H,4-8,11H2 |
| InChIKey | WSGJMLJDWIDLFH-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(4-aminocyclohexa-2,4-dien-1-yl)-(2-hydroxyethyl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-aminocyclohexa-2,4-dien-1-yl)-(2-hydroxyethyl)amino]ethanol?
The IUPAC name of 2-[(4-aminocyclohexa-2,4-dien-1-yl)-(2-hydroxyethyl)amino]ethanol (CID 129303960) is 2-[(4-aminocyclohexa-2,4-dien-1-yl)-(2-hydroxyethyl)amino]ethanol.
What is the SMILES notation for 2-[(4-aminocyclohexa-2,4-dien-1-yl)-(2-hydroxyethyl)amino]ethanol?
The canonical SMILES for 2-[(4-aminocyclohexa-2,4-dien-1-yl)-(2-hydroxyethyl)amino]ethanol is NC1=CCC(N(CCO)CCO)C=C1.
What is the InChIKey of 2-[(4-aminocyclohexa-2,4-dien-1-yl)-(2-hydroxyethyl)amino]ethanol?
The InChIKey is WSGJMLJDWIDLFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O2/c11-9-1-3-10(4-2-9)12(5-7-13)6-8-14/h1-3,10,13-14H,4-8,11H2.
What are the key properties of 2-[(4-aminocyclohexa-2,4-dien-1-yl)-(2-hydroxyethyl)amino]ethanol?
2-[(4-aminocyclohexa-2,4-dien-1-yl)-(2-hydroxyethyl)amino]ethanol has a molecular weight of 198.27 g/mol, XLogP of -0.56, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-aminocyclohexa-2,4-dien-1-yl)-(2-hydroxyethyl)amino]ethanol is sourced from PubChem (CID 129303960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).