C9H10FN3 — CID 129304225
(1E,3Z)-5-fluoro-2-(1H-imidazol-2-yl)hexa-1,3,5-trien-1-amine (PubChem CID 129304225) has the molecular formula C9H10FN3 and a molecular weight of 179.20 g/mol. Its IUPAC name is (1E,3Z)-5-fluoro-2-(1H-imidazol-2-yl)hexa-1,3,5-trien-1-amine.
| Compound Name | (1E,3Z)-5-fluoro-2-(1H-imidazol-2-yl)hexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 129304225 |
| Molecular Formula | C9H10FN3 |
| Molecular Weight | 179.20 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | (1E,3Z)-5-fluoro-2-(1H-imidazol-2-yl)hexa-1,3,5-trien-1-amine |
| SMILES | C=C(F)/C=C\C(=C/N)c1ncc[nH]1 |
| InChI | InChI=1S/C9H10FN3/c1-7(10)2-3-8(6-11)9-12-4-5-13-9/h2-6H,1,11H2,(H,12,13)/b3-2-,8-6+ |
| InChIKey | NHDSSAIVXNSHPE-LGVURTOVSA-N |
| XLogP | 1.75 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.20 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|