C15H22FNO2 — CID 129304329
2-[(1R,5S,6S)-6-(aminomethyl)-3-[(1-fluorocyclobutyl)methyl]-6-bicyclo[3.2.0]hept-3-enyl]acetic acid (PubChem CID 129304329) has the molecular formula C15H22FNO2 and a molecular weight of 267.34 g/mol. Its IUPAC name is 2-[(1R,5S,6S)-6-(aminomethyl)-3-[(1-fluorocyclobutyl)methyl]-6-bicyclo[3.2.0]hept-3-enyl]acetic acid.
| Compound Name | 2-[(1R,5S,6S)-6-(aminomethyl)-3-[(1-fluorocyclobutyl)methyl]-6-bicyclo[3.2.0]hept-3-enyl]acetic acid |
|---|---|
| PubChem CID | 129304329 |
| Molecular Formula | C15H22FNO2 |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 2-[(1R,5S,6S)-6-(aminomethyl)-3-[(1-fluorocyclobutyl)methyl]-6-bicyclo[3.2.0]hept-3-enyl]acetic acid |
| SMILES | NC[C@]1(CC(=O)O)C[C@H]2CC(CC3(F)CCC3)=C[C@H]21 |
| InChI | InChI=1S/C15H22FNO2/c16-15(2-1-3-15)6-10-4-11-7-14(9-17,8-13(18)19)12(11)5-10/h5,11-12H,1-4,6-9,17H2,(H,18,19)/t11-,12-,14-/m1/s1 |
| InChIKey | ZOPNGOHVBPDLMQ-YRGRVCCFSA-N |
| XLogP | 2.65 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|