C16H22FNO2 — CID 129304337
(4R,6S)-2-(aminomethyl)-8-[(1-fluorocyclobutyl)methyl]tricyclo[4.3.0.01,4]non-8-ene-3-carboxylic acid (PubChem CID 129304337) has the molecular formula C16H22FNO2 and a molecular weight of 279.36 g/mol. Its IUPAC name is (4R,6S)-2-(aminomethyl)-8-[(1-fluorocyclobutyl)methyl]tricyclo[4.3.0.01,4]non-8-ene-3-carboxylic acid.
| Compound Name | (4R,6S)-2-(aminomethyl)-8-[(1-fluorocyclobutyl)methyl]tricyclo[4.3.0.01,4]non-8-ene-3-carboxylic acid |
|---|---|
| PubChem CID | 129304337 |
| Molecular Formula | C16H22FNO2 |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | (4R,6S)-2-(aminomethyl)-8-[(1-fluorocyclobutyl)methyl]tricyclo[4.3.0.01,4]non-8-ene-3-carboxylic acid |
| SMILES | NCC1C(C(=O)O)[C@H]2C[C@H]3CC(CC4(F)CCC4)=CC132 |
| InChI | InChI=1S/C16H22FNO2/c17-15(2-1-3-15)6-9-4-10-5-11-13(14(19)20)12(8-18)16(10,11)7-9/h7,10-13H,1-6,8,18H2,(H,19,20)/t10-,11-,12?,13?,16?/m1/s1 |
| InChIKey | UBWQBYNXYXJSEH-MKLDRDRKSA-N |
| XLogP | 2.51 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|