About 4-amino-3-[(1R,5R)-3-[(1-fluorocyclopropyl)methyl]-6-bicyclo[3.2.0]hept-2-enyl]butanoic acid
4-amino-3-[(1R,5R)-3-[(1-fluorocyclopropyl)methyl]-6-bicyclo[3.2.0]hept-2-enyl]butanoic acid (PubChem CID 129304372) has the molecular formula C15H22FNO2
and a molecular weight of 267.34 g/mol. Its IUPAC name is 4-amino-3-[(1R,5R)-3-[(1-fluorocyclopropyl)methyl]-6-bicyclo[3.2.0]hept-2-enyl]butanoic acid.
Molecular Properties
| Compound Name | 4-amino-3-[(1R,5R)-3-[(1-fluorocyclopropyl)methyl]-6-bicyclo[3.2.0]hept-2-enyl]butanoic acid |
| PubChem CID | 129304372 |
| Molecular Formula | C15H22FNO2 |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 4-amino-3-[(1R,5R)-3-[(1-fluorocyclopropyl)methyl]-6-bicyclo[3.2.0]hept-2-enyl]butanoic acid |
| SMILES | NCC(CC(=O)O)C1C[C@H]2C=C(CC3(F)CC3)C[C@@H]12 |
| InChI | InChI=1S/C15H22FNO2/c16-15(1-2-15)7-9-3-10-5-13(12(10)4-9)11(8-17)6-14(18)19/h3,10-13H,1-2,4-8,17H2,(H,18,19)/t10-,11?,12-,13?/m1/s1 |
| InChIKey | BNRWOVDWUGEVEF-CQLXCSJHSA-N |
| XLogP | 2.51 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-3-[(1R,5R)-3-[(1-fluorocyclopropyl)methyl]-6-bicyclo[3.2.0]hept-2-enyl]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-3-[(1R,5R)-3-[(1-fluorocyclopropyl)methyl]-6-bicyclo[3.2.0]hept-2-enyl]butanoic acid?
The IUPAC name of 4-amino-3-[(1R,5R)-3-[(1-fluorocyclopropyl)methyl]-6-bicyclo[3.2.0]hept-2-enyl]butanoic acid (CID 129304372) is 4-amino-3-[(1R,5R)-3-[(1-fluorocyclopropyl)methyl]-6-bicyclo[3.2.0]hept-2-enyl]butanoic acid.
What is the SMILES notation for 4-amino-3-[(1R,5R)-3-[(1-fluorocyclopropyl)methyl]-6-bicyclo[3.2.0]hept-2-enyl]butanoic acid?
The canonical SMILES for 4-amino-3-[(1R,5R)-3-[(1-fluorocyclopropyl)methyl]-6-bicyclo[3.2.0]hept-2-enyl]butanoic acid is NCC(CC(=O)O)C1C[C@H]2C=C(CC3(F)CC3)C[C@@H]12.
What is the InChIKey of 4-amino-3-[(1R,5R)-3-[(1-fluorocyclopropyl)methyl]-6-bicyclo[3.2.0]hept-2-enyl]butanoic acid?
The InChIKey is BNRWOVDWUGEVEF-CQLXCSJHSA-N. The full InChI is InChI=1S/C15H22FNO2/c16-15(1-2-15)7-9-3-10-5-13(12(10)4-9)11(8-17)6-14(18)19/h3,10-13H,1-2,4-8,17H2,(H,18,19)/t10-,11?,12-,13?/m1/s1.
What are the key properties of 4-amino-3-[(1R,5R)-3-[(1-fluorocyclopropyl)methyl]-6-bicyclo[3.2.0]hept-2-enyl]butanoic acid?
4-amino-3-[(1R,5R)-3-[(1-fluorocyclopropyl)methyl]-6-bicyclo[3.2.0]hept-2-enyl]butanoic acid has a molecular weight of 267.34 g/mol, XLogP of 2.51, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3-[(1R,5R)-3-[(1-fluorocyclopropyl)methyl]-6-bicyclo[3.2.0]hept-2-enyl]butanoic acid is sourced from PubChem (CID 129304372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).