C15H24FN — CID 129304379
[(1S,5R,6S)-6-ethyl-3-[(1-fluorocyclobutyl)methyl]-6-bicyclo[3.2.0]hept-3-enyl]methanamine (PubChem CID 129304379) has the molecular formula C15H24FN and a molecular weight of 237.36 g/mol. Its IUPAC name is [(1S,5R,6S)-6-ethyl-3-[(1-fluorocyclobutyl)methyl]-6-bicyclo[3.2.0]hept-3-enyl]methanamine.
| Compound Name | [(1S,5R,6S)-6-ethyl-3-[(1-fluorocyclobutyl)methyl]-6-bicyclo[3.2.0]hept-3-enyl]methanamine |
|---|---|
| PubChem CID | 129304379 |
| Molecular Formula | C15H24FN |
| Molecular Weight | 237.36 g/mol |
| Exact Mass | 237.19 |
| IUPAC Name | [(1S,5R,6S)-6-ethyl-3-[(1-fluorocyclobutyl)methyl]-6-bicyclo[3.2.0]hept-3-enyl]methanamine |
| SMILES | CC[C@]1(CN)C[C@@H]2CC(CC3(F)CCC3)=C[C@@H]21 |
| InChI | InChI=1S/C15H24FN/c1-2-14(10-17)9-12-6-11(7-13(12)14)8-15(16)4-3-5-15/h7,12-13H,2-6,8-10,17H2,1H3/t12-,13-,14+/m0/s1 |
| InChIKey | NQRCDVIRIFPDQL-MELADBBJSA-N |
| XLogP | 3.59 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.36 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|