C10H14FNO4 — CID 129304442
2-[(1S,3S,5R,6S)-3-fluoro-6-(nitromethyl)-6-bicyclo[3.2.0]heptanyl]acetic acid (PubChem CID 129304442) has the molecular formula C10H14FNO4 and a molecular weight of 231.22 g/mol. Its IUPAC name is 2-[(1S,3S,5R,6S)-3-fluoro-6-(nitromethyl)-6-bicyclo[3.2.0]heptanyl]acetic acid.
| Compound Name | 2-[(1S,3S,5R,6S)-3-fluoro-6-(nitromethyl)-6-bicyclo[3.2.0]heptanyl]acetic acid |
|---|---|
| PubChem CID | 129304442 |
| Molecular Formula | C10H14FNO4 |
| Molecular Weight | 231.22 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 2-[(1S,3S,5R,6S)-3-fluoro-6-(nitromethyl)-6-bicyclo[3.2.0]heptanyl]acetic acid |
| SMILES | O=C(O)C[C@@]1(C[N+](=O)[O-])C[C@H]2C[C@H](F)C[C@H]21 |
| InChI | InChI=1S/C10H14FNO4/c11-7-1-6-3-10(4-9(13)14,5-12(15)16)8(6)2-7/h6-8H,1-5H2,(H,13,14)/t6-,7+,8-,10-/m1/s1 |
| InChIKey | MTORUXHNTLOQSF-IBCQBUCCSA-N |
| XLogP | 1.49 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.22 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|