C12H18FNO4 — CID 129304459
ethyl 2-[(1R,3R,5S,6R)-3-fluoro-6-(nitromethyl)-6-bicyclo[3.2.0]heptanyl]acetate (PubChem CID 129304459) has the molecular formula C12H18FNO4 and a molecular weight of 259.28 g/mol. Its IUPAC name is ethyl 2-[(1R,3R,5S,6R)-3-fluoro-6-(nitromethyl)-6-bicyclo[3.2.0]heptanyl]acetate.
| Compound Name | ethyl 2-[(1R,3R,5S,6R)-3-fluoro-6-(nitromethyl)-6-bicyclo[3.2.0]heptanyl]acetate |
|---|---|
| PubChem CID | 129304459 |
| Molecular Formula | C12H18FNO4 |
| Molecular Weight | 259.28 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | ethyl 2-[(1R,3R,5S,6R)-3-fluoro-6-(nitromethyl)-6-bicyclo[3.2.0]heptanyl]acetate |
| SMILES | CCOC(=O)C[C@]1(C[N+](=O)[O-])C[C@@H]2C[C@@H](F)C[C@@H]21 |
| InChI | InChI=1S/C12H18FNO4/c1-2-18-11(15)6-12(7-14(16)17)5-8-3-9(13)4-10(8)12/h8-10H,2-7H2,1H3/t8-,9+,10-,12-/m0/s1 |
| InChIKey | XKHCZHBJEIMGDE-WYFGTUCQSA-N |
| XLogP | 1.97 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.28 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|