C32H40O2 — CID 129304688
(8S,11R,13S,14S,17S)-17-(3,3-dimethylbut-1-ynyl)-11-(4-ethylphenyl)-17-hydroxy-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 129304688) has the molecular formula C32H40O2 and a molecular weight of 456.67 g/mol. Its IUPAC name is (8S,11R,13S,14S,17S)-17-(3,3-dimethylbut-1-ynyl)-11-(4-ethylphenyl)-17-hydroxy-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,11R,13S,14S,17S)-17-(3,3-dimethylbut-1-ynyl)-11-(4-ethylphenyl)-17-hydroxy-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 129304688 |
| Molecular Formula | C32H40O2 |
| Molecular Weight | 456.67 g/mol |
| Exact Mass | 456.30 |
| IUPAC Name | (8S,11R,13S,14S,17S)-17-(3,3-dimethylbut-1-ynyl)-11-(4-ethylphenyl)-17-hydroxy-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CCc1ccc([C@H]2C[C@@]3(C)[C@@H](CC[C@@]3(O)C#CC(C)(C)C)[C@@H]3CCC4=CC(=O)CCC4=C32)cc1 |
| InChI | InChI=1S/C32H40O2/c1-6-21-7-9-22(10-8-21)27-20-31(5)28(15-16-32(31,34)18-17-30(2,3)4)26-13-11-23-19-24(33)12-14-25(23)29(26)27/h7-10,19,26-28,34H,6,11-16,20H2,1-5H3/t26-,27+,28-,31-,32+/m0/s1 |
| InChIKey | GHPFPMOXWGCSJN-SSKMXYOESA-N |
| XLogP | 6.93 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.67 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|