C30H35FO2 — CID 129304731
(8S,11R,13S,14S,17S)-11-(3-fluoro-4-methylphenyl)-17-hydroxy-13-methyl-17-(3-methylbut-1-ynyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 129304731) has the molecular formula C30H35FO2 and a molecular weight of 446.61 g/mol. Its IUPAC name is (8S,11R,13S,14S,17S)-11-(3-fluoro-4-methylphenyl)-17-hydroxy-13-methyl-17-(3-methylbut-1-ynyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,11R,13S,14S,17S)-11-(3-fluoro-4-methylphenyl)-17-hydroxy-13-methyl-17-(3-methylbut-1-ynyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 129304731 |
| Molecular Formula | C30H35FO2 |
| Molecular Weight | 446.61 g/mol |
| Exact Mass | 446.26 |
| IUPAC Name | (8S,11R,13S,14S,17S)-11-(3-fluoro-4-methylphenyl)-17-hydroxy-13-methyl-17-(3-methylbut-1-ynyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | Cc1ccc([C@H]2C[C@@]3(C)[C@@H](CC[C@@]3(O)C#CC(C)C)[C@@H]3CCC4=CC(=O)CCC4=C32)cc1F |
| InChI | InChI=1S/C30H35FO2/c1-18(2)11-13-30(33)14-12-26-24-9-7-20-15-22(32)8-10-23(20)28(24)25(17-29(26,30)4)21-6-5-19(3)27(31)16-21/h5-6,15-16,18,24-26,33H,7-10,12,14,17H2,1-4H3/t24-,25+,26-,29-,30-/m0/s1 |
| InChIKey | CQFFANHSUBXNAP-GJDJGZIVSA-N |
| XLogP | 6.42 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.61 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|