C31H37FO2 — CID 129304735
(8S,11R,13S,14S,17S)-17-(3,3-dimethylbut-1-ynyl)-11-(3-fluoro-4-methylphenyl)-17-hydroxy-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 129304735) has the molecular formula C31H37FO2 and a molecular weight of 460.63 g/mol. Its IUPAC name is (8S,11R,13S,14S,17S)-17-(3,3-dimethylbut-1-ynyl)-11-(3-fluoro-4-methylphenyl)-17-hydroxy-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,11R,13S,14S,17S)-17-(3,3-dimethylbut-1-ynyl)-11-(3-fluoro-4-methylphenyl)-17-hydroxy-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 129304735 |
| Molecular Formula | C31H37FO2 |
| Molecular Weight | 460.63 g/mol |
| Exact Mass | 460.28 |
| IUPAC Name | (8S,11R,13S,14S,17S)-17-(3,3-dimethylbut-1-ynyl)-11-(3-fluoro-4-methylphenyl)-17-hydroxy-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | Cc1ccc([C@H]2C[C@@]3(C)[C@@H](CC[C@@]3(O)C#CC(C)(C)C)[C@@H]3CCC4=CC(=O)CCC4=C32)cc1F |
| InChI | InChI=1S/C31H37FO2/c1-19-6-7-21(17-27(19)32)25-18-30(5)26(12-13-31(30,34)15-14-29(2,3)4)24-10-8-20-16-22(33)9-11-23(20)28(24)25/h6-7,16-17,24-26,34H,8-13,18H2,1-5H3/t24-,25+,26-,30-,31+/m0/s1 |
| InChIKey | HLUSBJGKWMMSNK-ILVQRKGQSA-N |
| XLogP | 6.81 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.63 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|