C34H35F2NO2 — CID 129304738
(8S,11S,13S,14S,17S)-11-[4-(dimethylamino)-2,6-difluorophenyl]-17-hydroxy-13-methyl-17-(2-phenylethynyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 129304738) has the molecular formula C34H35F2NO2 and a molecular weight of 527.66 g/mol. Its IUPAC name is (8S,11S,13S,14S,17S)-11-[4-(dimethylamino)-2,6-difluorophenyl]-17-hydroxy-13-methyl-17-(2-phenylethynyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,11S,13S,14S,17S)-11-[4-(dimethylamino)-2,6-difluorophenyl]-17-hydroxy-13-methyl-17-(2-phenylethynyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 129304738 |
| Molecular Formula | C34H35F2NO2 |
| Molecular Weight | 527.66 g/mol |
| Exact Mass | 527.26 |
| IUPAC Name | (8S,11S,13S,14S,17S)-11-[4-(dimethylamino)-2,6-difluorophenyl]-17-hydroxy-13-methyl-17-(2-phenylethynyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CN(C)c1cc(F)c([C@H]2C[C@@]3(C)[C@@H](CC[C@@]3(O)C#Cc3ccccc3)[C@@H]3CCC4=CC(=O)CCC4=C32)c(F)c1 |
| InChI | InChI=1S/C34H35F2NO2/c1-33-20-27(32-29(35)18-23(37(2)3)19-30(32)36)31-25-12-10-24(38)17-22(25)9-11-26(31)28(33)14-16-34(33,39)15-13-21-7-5-4-6-8-21/h4-8,17-19,26-28,39H,9-12,14,16,20H2,1-3H3/t26-,27-,28-,33-,34-/m0/s1 |
| InChIKey | MFPGBGWASMHDGT-GCCHKAGESA-N |
| XLogP | 6.71 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.66 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|