C28H27F5O2 — CID 129304744
(8S,11R,13S,14S,17S)-11-(3,5-difluoro-4-methylphenyl)-17-hydroxy-13-methyl-17-(3,3,3-trifluoroprop-1-ynyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 129304744) has the molecular formula C28H27F5O2 and a molecular weight of 490.51 g/mol. Its IUPAC name is (8S,11R,13S,14S,17S)-11-(3,5-difluoro-4-methylphenyl)-17-hydroxy-13-methyl-17-(3,3,3-trifluoroprop-1-ynyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,11R,13S,14S,17S)-11-(3,5-difluoro-4-methylphenyl)-17-hydroxy-13-methyl-17-(3,3,3-trifluoroprop-1-ynyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 129304744 |
| Molecular Formula | C28H27F5O2 |
| Molecular Weight | 490.51 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | (8S,11R,13S,14S,17S)-11-(3,5-difluoro-4-methylphenyl)-17-hydroxy-13-methyl-17-(3,3,3-trifluoroprop-1-ynyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | Cc1c(F)cc([C@H]2C[C@@]3(C)[C@@H](CC[C@@]3(O)C#CC(F)(F)F)[C@@H]3CCC4=CC(=O)CCC4=C32)cc1F |
| InChI | InChI=1S/C28H27F5O2/c1-15-23(29)12-17(13-24(15)30)21-14-26(2)22(7-8-27(26,35)9-10-28(31,32)33)20-5-3-16-11-18(34)4-6-19(16)25(20)21/h11-13,20-22,35H,3-8,14H2,1-2H3/t20-,21+,22-,26-,27+/m0/s1 |
| InChIKey | LBAPKQFJOQUWAM-KDPBODAISA-N |
| XLogP | 6.47 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.51 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|