C28H28F4O2 — CID 129304773
(8S,11R,13S,14S,17S)-11-(3-fluoro-4-methylphenyl)-17-hydroxy-13-methyl-17-(3,3,3-trifluoroprop-1-ynyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 129304773) has the molecular formula C28H28F4O2 and a molecular weight of 472.52 g/mol. Its IUPAC name is (8S,11R,13S,14S,17S)-11-(3-fluoro-4-methylphenyl)-17-hydroxy-13-methyl-17-(3,3,3-trifluoroprop-1-ynyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,11R,13S,14S,17S)-11-(3-fluoro-4-methylphenyl)-17-hydroxy-13-methyl-17-(3,3,3-trifluoroprop-1-ynyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 129304773 |
| Molecular Formula | C28H28F4O2 |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | (8S,11R,13S,14S,17S)-11-(3-fluoro-4-methylphenyl)-17-hydroxy-13-methyl-17-(3,3,3-trifluoroprop-1-ynyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | Cc1ccc([C@H]2C[C@@]3(C)[C@@H](CC[C@@]3(O)C#CC(F)(F)F)[C@@H]3CCC4=CC(=O)CCC4=C32)cc1F |
| InChI | InChI=1S/C28H28F4O2/c1-16-3-4-18(14-24(16)29)22-15-26(2)23(9-10-27(26,34)11-12-28(30,31)32)21-7-5-17-13-19(33)6-8-20(17)25(21)22/h3-4,13-14,21-23,34H,5-10,15H2,1-2H3/t21-,22+,23-,26-,27+/m0/s1 |
| InChIKey | JOGLGDJRJSJFTQ-KCXTWHPGSA-N |
| XLogP | 6.33 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|