C16H16F6N6O3 — CID 129304809
2-N,2-N-diethyl-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4-N-(3-nitrophenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 129304809) has the molecular formula C16H16F6N6O3 and a molecular weight of 454.33 g/mol. Its IUPAC name is 2-N,2-N-diethyl-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4-N-(3-nitrophenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,2-N-diethyl-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4-N-(3-nitrophenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 129304809 |
| Molecular Formula | C16H16F6N6O3 |
| Molecular Weight | 454.33 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | 2-N,2-N-diethyl-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4-N-(3-nitrophenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CCN(CC)c1nc(Nc2cccc([N+](=O)[O-])c2)nc(OC(C(F)(F)F)C(F)(F)F)n1 |
| InChI | InChI=1S/C16H16F6N6O3/c1-3-27(4-2)13-24-12(23-9-6-5-7-10(8-9)28(29)30)25-14(26-13)31-11(15(17,18)19)16(20,21)22/h5-8,11H,3-4H2,1-2H3,(H,23,24,25,26) |
| InChIKey | NDFLPIWKRXACOV-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 106.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.33 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|