C16H16F7N5O — CID 129304815
2-N,2-N-diethyl-4-N-(4-fluorophenyl)-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1,3,5-triazine-2,4-diamine (PubChem CID 129304815) has the molecular formula C16H16F7N5O and a molecular weight of 427.32 g/mol. Its IUPAC name is 2-N,2-N-diethyl-4-N-(4-fluorophenyl)-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,2-N-diethyl-4-N-(4-fluorophenyl)-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 129304815 |
| Molecular Formula | C16H16F7N5O |
| Molecular Weight | 427.32 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | 2-N,2-N-diethyl-4-N-(4-fluorophenyl)-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1,3,5-triazine-2,4-diamine |
| SMILES | CCN(CC)c1nc(Nc2ccc(F)cc2)nc(OC(C(F)(F)F)C(F)(F)F)n1 |
| InChI | InChI=1S/C16H16F7N5O/c1-3-28(4-2)13-25-12(24-10-7-5-9(17)6-8-10)26-14(27-13)29-11(15(18,19)20)16(21,22)23/h5-8,11H,3-4H2,1-2H3,(H,24,25,26,27) |
| InChIKey | GDNJUHRXDYPPJG-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.32 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |