C17H19F4N5O3 — CID 129304818
3-[[4-(diethylamino)-6-(2,2,3,3-tetrafluoropropoxy)-1,3,5-triazin-2-yl]amino]benzoic acid (PubChem CID 129304818) has the molecular formula C17H19F4N5O3 and a molecular weight of 417.36 g/mol. Its IUPAC name is 3-[[4-(diethylamino)-6-(2,2,3,3-tetrafluoropropoxy)-1,3,5-triazin-2-yl]amino]benzoic acid.
| Compound Name | 3-[[4-(diethylamino)-6-(2,2,3,3-tetrafluoropropoxy)-1,3,5-triazin-2-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 129304818 |
| Molecular Formula | C17H19F4N5O3 |
| Molecular Weight | 417.36 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 3-[[4-(diethylamino)-6-(2,2,3,3-tetrafluoropropoxy)-1,3,5-triazin-2-yl]amino]benzoic acid |
| SMILES | CCN(CC)c1nc(Nc2cccc(C(=O)O)c2)nc(OCC(F)(F)C(F)F)n1 |
| InChI | InChI=1S/C17H19F4N5O3/c1-3-26(4-2)15-23-14(22-11-7-5-6-10(8-11)12(27)28)24-16(25-15)29-9-17(20,21)13(18)19/h5-8,13H,3-4,9H2,1-2H3,(H,27,28)(H,22,23,24,25) |
| InChIKey | AKBYBQIPWPJVNZ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 100.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.36 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|