C31H36F2O2 — CID 129304848
(8S,11R,13S,14S,17S)-11-(3,5-difluoro-4-methylphenyl)-17-(3,3-dimethylbut-1-ynyl)-17-hydroxy-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 129304848) has the molecular formula C31H36F2O2 and a molecular weight of 478.62 g/mol. Its IUPAC name is (8S,11R,13S,14S,17S)-11-(3,5-difluoro-4-methylphenyl)-17-(3,3-dimethylbut-1-ynyl)-17-hydroxy-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,11R,13S,14S,17S)-11-(3,5-difluoro-4-methylphenyl)-17-(3,3-dimethylbut-1-ynyl)-17-hydroxy-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 129304848 |
| Molecular Formula | C31H36F2O2 |
| Molecular Weight | 478.62 g/mol |
| Exact Mass | 478.27 |
| IUPAC Name | (8S,11R,13S,14S,17S)-11-(3,5-difluoro-4-methylphenyl)-17-(3,3-dimethylbut-1-ynyl)-17-hydroxy-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | Cc1c(F)cc([C@H]2C[C@@]3(C)[C@@H](CC[C@@]3(O)C#CC(C)(C)C)[C@@H]3CCC4=CC(=O)CCC4=C32)cc1F |
| InChI | InChI=1S/C31H36F2O2/c1-18-26(32)15-20(16-27(18)33)24-17-30(5)25(10-11-31(30,35)13-12-29(2,3)4)23-8-6-19-14-21(34)7-9-22(19)28(23)24/h14-16,23-25,35H,6-11,17H2,1-5H3/t23-,24+,25-,30-,31+/m0/s1 |
| InChIKey | PLZYGOYGGLBKBH-IEMGZYBISA-N |
| XLogP | 6.95 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.62 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|