C17H21N3 — CID 129306657
2-cyclohexa-1,3-dien-1-yl-6-(6-methylcyclohex-3-en-1-yl)-6H-1,3,5-triazepine (PubChem CID 129306657) has the molecular formula C17H21N3 and a molecular weight of 267.38 g/mol. Its IUPAC name is 2-cyclohexa-1,3-dien-1-yl-6-(6-methylcyclohex-3-en-1-yl)-6H-1,3,5-triazepine.
| Compound Name | 2-cyclohexa-1,3-dien-1-yl-6-(6-methylcyclohex-3-en-1-yl)-6H-1,3,5-triazepine |
|---|---|
| PubChem CID | 129306657 |
| Molecular Formula | C17H21N3 |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 2-cyclohexa-1,3-dien-1-yl-6-(6-methylcyclohex-3-en-1-yl)-6H-1,3,5-triazepine |
| SMILES | CC1CC=CCC1C1C=NC(C2=CC=CCC2)=NC=N1 |
| InChI | InChI=1S/C17H21N3/c1-13-7-5-6-10-15(13)16-11-18-17(20-12-19-16)14-8-3-2-4-9-14/h2-3,5-6,8,11-13,15-16H,4,7,9-10H2,1H3 |
| InChIKey | KXZBKUMHUOSTEG-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|