C33H41NO3 — CID 129307108
(8S,11R,13S,14S,16R,17S)-17-hydroxy-13,16-dimethyl-11-[4-[(3R)-3-methylmorpholin-4-yl]phenyl]-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 129307108) has the molecular formula C33H41NO3 and a molecular weight of 499.70 g/mol. Its IUPAC name is (8S,11R,13S,14S,16R,17S)-17-hydroxy-13,16-dimethyl-11-[4-[(3R)-3-methylmorpholin-4-yl]phenyl]-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,11R,13S,14S,16R,17S)-17-hydroxy-13,16-dimethyl-11-[4-[(3R)-3-methylmorpholin-4-yl]phenyl]-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 129307108 |
| Molecular Formula | C33H41NO3 |
| Molecular Weight | 499.70 g/mol |
| Exact Mass | 499.31 |
| IUPAC Name | (8S,11R,13S,14S,16R,17S)-17-hydroxy-13,16-dimethyl-11-[4-[(3R)-3-methylmorpholin-4-yl]phenyl]-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC#C[C@]1(O)[C@H](C)C[C@H]2[C@@H]3CCC4=CC(=O)CCC4=C3[C@@H](c3ccc(N4CCOC[C@H]4C)cc3)C[C@@]21C |
| InChI | InChI=1S/C33H41NO3/c1-5-14-33(36)21(2)17-30-28-12-8-24-18-26(35)11-13-27(24)31(28)29(19-32(30,33)4)23-6-9-25(10-7-23)34-15-16-37-20-22(34)3/h6-7,9-10,18,21-22,28-30,36H,8,11-13,15-17,19-20H2,1-4H3/t21-,22-,28+,29-,30+,32+,33+/m1/s1 |
| InChIKey | YCNMMOVYPXQOME-QZQGAOQXSA-N |
| XLogP | 5.81 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.70 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|