About (E)-1-phenyl-N-trimethylsilylpentan-1-imine
(E)-1-phenyl-N-trimethylsilylpentan-1-imine (PubChem CID 12930777) has the molecular formula C14H23NSi
and a molecular weight of 233.43 g/mol. Its IUPAC name is (E)-1-phenyl-N-trimethylsilylpentan-1-imine.
Molecular Properties
| Compound Name | (E)-1-phenyl-N-trimethylsilylpentan-1-imine |
| PubChem CID | 12930777 |
| Molecular Formula | C14H23NSi |
| Molecular Weight | 233.43 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | (E)-1-phenyl-N-trimethylsilylpentan-1-imine |
| SMILES | CCCC/C(=N\[Si](C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C14H23NSi/c1-5-6-12-14(15-16(2,3)4)13-10-8-7-9-11-13/h7-11H,5-6,12H2,1-4H3/b15-14+ |
| InChIKey | CHPIUOFNMJCTBH-CCEZHUSRSA-N |
| XLogP | 4.50 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.43 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-phenyl-N-trimethylsilylpentan-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-phenyl-N-trimethylsilylpentan-1-imine?
The IUPAC name of (E)-1-phenyl-N-trimethylsilylpentan-1-imine (CID 12930777) is (E)-1-phenyl-N-trimethylsilylpentan-1-imine.
What is the SMILES notation for (E)-1-phenyl-N-trimethylsilylpentan-1-imine?
The canonical SMILES for (E)-1-phenyl-N-trimethylsilylpentan-1-imine is CCCC/C(=N\[Si](C)(C)C)c1ccccc1.
What is the InChIKey of (E)-1-phenyl-N-trimethylsilylpentan-1-imine?
The InChIKey is CHPIUOFNMJCTBH-CCEZHUSRSA-N. The full InChI is InChI=1S/C14H23NSi/c1-5-6-12-14(15-16(2,3)4)13-10-8-7-9-11-13/h7-11H,5-6,12H2,1-4H3/b15-14+.
What are the key properties of (E)-1-phenyl-N-trimethylsilylpentan-1-imine?
(E)-1-phenyl-N-trimethylsilylpentan-1-imine has a molecular weight of 233.43 g/mol, XLogP of 4.50, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-phenyl-N-trimethylsilylpentan-1-imine is sourced from PubChem (CID 12930777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).