C13H14N2 — CID 129308037
9-methyl-1,2,3,4-tetrahydro-1,10-phenanthroline (PubChem CID 129308037) has the molecular formula C13H14N2 and a molecular weight of 198.27 g/mol. Its IUPAC name is 9-methyl-1,2,3,4-tetrahydro-1,10-phenanthroline.
| Compound Name | 9-methyl-1,2,3,4-tetrahydro-1,10-phenanthroline |
|---|---|
| PubChem CID | 129308037 |
| Molecular Formula | C13H14N2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 9-methyl-1,2,3,4-tetrahydro-1,10-phenanthroline |
| SMILES | Cc1ccc2ccc3c(c2n1)NCCC3 |
| InChI | InChI=1S/C13H14N2/c1-9-4-5-11-7-6-10-3-2-8-14-12(10)13(11)15-9/h4-7,14H,2-3,8H2,1H3 |
| InChIKey | RLQADBPLKUYGKC-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |