About 7-(methoxymethyl)-10,11-dimethyltricyclo[7.4.1.01,5]tetradec-7-en-14-one
7-(methoxymethyl)-10,11-dimethyltricyclo[7.4.1.01,5]tetradec-7-en-14-one (PubChem CID 129308246) has the molecular formula C18H28O2
and a molecular weight of 276.42 g/mol. Its IUPAC name is 7-(methoxymethyl)-10,11-dimethyltricyclo[7.4.1.01,5]tetradec-7-en-14-one.
Molecular Properties
| Compound Name | 7-(methoxymethyl)-10,11-dimethyltricyclo[7.4.1.01,5]tetradec-7-en-14-one |
| PubChem CID | 129308246 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | 7-(methoxymethyl)-10,11-dimethyltricyclo[7.4.1.01,5]tetradec-7-en-14-one |
| SMILES | COCC1=CC2C(=O)C3(CCCC3C1)CCC(C)C2C |
| InChI | InChI=1S/C18H28O2/c1-12-6-8-18-7-4-5-15(18)9-14(11-20-3)10-16(13(12)2)17(18)19/h10,12-13,15-16H,4-9,11H2,1-3H3 |
| InChIKey | ZMGGQQWFAMHQKI-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7-(methoxymethyl)-10,11-dimethyltricyclo[7.4.1.01,5]tetradec-7-en-14-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(methoxymethyl)-10,11-dimethyltricyclo[7.4.1.01,5]tetradec-7-en-14-one?
The IUPAC name of 7-(methoxymethyl)-10,11-dimethyltricyclo[7.4.1.01,5]tetradec-7-en-14-one (CID 129308246) is 7-(methoxymethyl)-10,11-dimethyltricyclo[7.4.1.01,5]tetradec-7-en-14-one.
What is the SMILES notation for 7-(methoxymethyl)-10,11-dimethyltricyclo[7.4.1.01,5]tetradec-7-en-14-one?
The canonical SMILES for 7-(methoxymethyl)-10,11-dimethyltricyclo[7.4.1.01,5]tetradec-7-en-14-one is COCC1=CC2C(=O)C3(CCCC3C1)CCC(C)C2C.
What is the InChIKey of 7-(methoxymethyl)-10,11-dimethyltricyclo[7.4.1.01,5]tetradec-7-en-14-one?
The InChIKey is ZMGGQQWFAMHQKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28O2/c1-12-6-8-18-7-4-5-15(18)9-14(11-20-3)10-16(13(12)2)17(18)19/h10,12-13,15-16H,4-9,11H2,1-3H3.
What are the key properties of 7-(methoxymethyl)-10,11-dimethyltricyclo[7.4.1.01,5]tetradec-7-en-14-one?
7-(methoxymethyl)-10,11-dimethyltricyclo[7.4.1.01,5]tetradec-7-en-14-one has a molecular weight of 276.42 g/mol, XLogP of 4.00, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(methoxymethyl)-10,11-dimethyltricyclo[7.4.1.01,5]tetradec-7-en-14-one is sourced from PubChem (CID 129308246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).