About 1-chloro-2-fluoro-3-[(E,3Z)-3-prop-2-enylidene-5-propylnon-4-enyl]cyclohexane
1-chloro-2-fluoro-3-[(E,3Z)-3-prop-2-enylidene-5-propylnon-4-enyl]cyclohexane (PubChem CID 129308666) has the molecular formula C21H34ClF
and a molecular weight of 340.95 g/mol. Its IUPAC name is 1-chloro-2-fluoro-3-[(E,3Z)-3-prop-2-enylidene-5-propylnon-4-enyl]cyclohexane.
Molecular Properties
| Compound Name | 1-chloro-2-fluoro-3-[(E,3Z)-3-prop-2-enylidene-5-propylnon-4-enyl]cyclohexane |
| PubChem CID | 129308666 |
| Molecular Formula | C21H34ClF |
| Molecular Weight | 340.95 g/mol |
| Exact Mass | 340.23 |
| IUPAC Name | 1-chloro-2-fluoro-3-[(E,3Z)-3-prop-2-enylidene-5-propylnon-4-enyl]cyclohexane |
| SMILES | C=C/C=C(\C=C(/CCC)CCCC)CCC1CCCC(Cl)C1F |
| InChI | InChI=1S/C21H34ClF/c1-4-7-11-17(9-5-2)16-18(10-6-3)14-15-19-12-8-13-20(22)21(19)23/h6,10,16,19-21H,3-5,7-9,11-15H2,1-2H3/b17-16+,18-10- |
| InChIKey | JBBNHEGUICKIDT-RESWCAQJSA-N |
| XLogP | 7.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 340.95 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-2-fluoro-3-[(E,3Z)-3-prop-2-enylidene-5-propylnon-4-enyl]cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-2-fluoro-3-[(E,3Z)-3-prop-2-enylidene-5-propylnon-4-enyl]cyclohexane?
The IUPAC name of 1-chloro-2-fluoro-3-[(E,3Z)-3-prop-2-enylidene-5-propylnon-4-enyl]cyclohexane (CID 129308666) is 1-chloro-2-fluoro-3-[(E,3Z)-3-prop-2-enylidene-5-propylnon-4-enyl]cyclohexane.
What is the SMILES notation for 1-chloro-2-fluoro-3-[(E,3Z)-3-prop-2-enylidene-5-propylnon-4-enyl]cyclohexane?
The canonical SMILES for 1-chloro-2-fluoro-3-[(E,3Z)-3-prop-2-enylidene-5-propylnon-4-enyl]cyclohexane is C=C/C=C(\C=C(/CCC)CCCC)CCC1CCCC(Cl)C1F.
What is the InChIKey of 1-chloro-2-fluoro-3-[(E,3Z)-3-prop-2-enylidene-5-propylnon-4-enyl]cyclohexane?
The InChIKey is JBBNHEGUICKIDT-RESWCAQJSA-N. The full InChI is InChI=1S/C21H34ClF/c1-4-7-11-17(9-5-2)16-18(10-6-3)14-15-19-12-8-13-20(22)21(19)23/h6,10,16,19-21H,3-5,7-9,11-15H2,1-2H3/b17-16+,18-10-.
What are the key properties of 1-chloro-2-fluoro-3-[(E,3Z)-3-prop-2-enylidene-5-propylnon-4-enyl]cyclohexane?
1-chloro-2-fluoro-3-[(E,3Z)-3-prop-2-enylidene-5-propylnon-4-enyl]cyclohexane has a molecular weight of 340.95 g/mol, XLogP of 7.54, 10 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-2-fluoro-3-[(E,3Z)-3-prop-2-enylidene-5-propylnon-4-enyl]cyclohexane is sourced from PubChem (CID 129308666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).