C17H23NO — CID 129308737
(2Z,4Z)-4-[(E)-2-[4-(methylamino)cyclohepta-1,3,5-trien-1-yl]ethenyl]hepta-2,4-dien-2-ol (PubChem CID 129308737) has the molecular formula C17H23NO and a molecular weight of 257.38 g/mol. Its IUPAC name is (2Z,4Z)-4-[(E)-2-[4-(methylamino)cyclohepta-1,3,5-trien-1-yl]ethenyl]hepta-2,4-dien-2-ol.
| Compound Name | (2Z,4Z)-4-[(E)-2-[4-(methylamino)cyclohepta-1,3,5-trien-1-yl]ethenyl]hepta-2,4-dien-2-ol |
|---|---|
| PubChem CID | 129308737 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | (2Z,4Z)-4-[(E)-2-[4-(methylamino)cyclohepta-1,3,5-trien-1-yl]ethenyl]hepta-2,4-dien-2-ol |
| SMILES | CC/C=C(\C=C(\C)O)/C=C/C1=CC=C(NC)C=CC1 |
| InChI | InChI=1S/C17H23NO/c1-4-6-16(13-14(2)19)10-9-15-7-5-8-17(18-3)12-11-15/h5-6,8-13,18-19H,4,7H2,1-3H3/b10-9+,14-13-,16-6- |
| InChIKey | YFCSVJXLXDQEDX-CBTZVKGASA-N |
| XLogP | 4.33 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|