About 4-(bromomethyl)-2,6-ditert-butylpyridine
4-(bromomethyl)-2,6-ditert-butylpyridine (PubChem CID 12930888) has the molecular formula C14H22BrN
and a molecular weight of 284.24 g/mol. Its IUPAC name is 4-(bromomethyl)-2,6-ditert-butylpyridine.
Molecular Properties
| Compound Name | 4-(bromomethyl)-2,6-ditert-butylpyridine |
| PubChem CID | 12930888 |
| Molecular Formula | C14H22BrN |
| Molecular Weight | 284.24 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 4-(bromomethyl)-2,6-ditert-butylpyridine |
| SMILES | CC(C)(C)c1cc(CBr)cc(C(C)(C)C)n1 |
| InChI | InChI=1S/C14H22BrN/c1-13(2,3)11-7-10(9-15)8-12(16-11)14(4,5)6/h7-8H,9H2,1-6H3 |
| InChIKey | KRGQGAXLBUQGQP-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.24 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(bromomethyl)-2,6-ditert-butylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(bromomethyl)-2,6-ditert-butylpyridine?
The IUPAC name of 4-(bromomethyl)-2,6-ditert-butylpyridine (CID 12930888) is 4-(bromomethyl)-2,6-ditert-butylpyridine.
What is the SMILES notation for 4-(bromomethyl)-2,6-ditert-butylpyridine?
The canonical SMILES for 4-(bromomethyl)-2,6-ditert-butylpyridine is CC(C)(C)c1cc(CBr)cc(C(C)(C)C)n1.
What is the InChIKey of 4-(bromomethyl)-2,6-ditert-butylpyridine?
The InChIKey is KRGQGAXLBUQGQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22BrN/c1-13(2,3)11-7-10(9-15)8-12(16-11)14(4,5)6/h7-8H,9H2,1-6H3.
What are the key properties of 4-(bromomethyl)-2,6-ditert-butylpyridine?
4-(bromomethyl)-2,6-ditert-butylpyridine has a molecular weight of 284.24 g/mol, XLogP of 4.57, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(bromomethyl)-2,6-ditert-butylpyridine is sourced from PubChem (CID 12930888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).