C59H17F20N3S — CID 129308911
1,6-bis[3,6-bis(2,3,4,5,6-pentafluorophenyl)carbazol-9-yl]-[1]benzothiolo[2,3-c]pyridine (PubChem CID 129308911) has the molecular formula C59H17F20N3S and a molecular weight of 1179.83 g/mol. Its IUPAC name is 1,6-bis[3,6-bis(2,3,4,5,6-pentafluorophenyl)carbazol-9-yl]-[1]benzothiolo[2,3-c]pyridine.
| Compound Name | 1,6-bis[3,6-bis(2,3,4,5,6-pentafluorophenyl)carbazol-9-yl]-[1]benzothiolo[2,3-c]pyridine |
|---|---|
| PubChem CID | 129308911 |
| Molecular Formula | C59H17F20N3S |
| Molecular Weight | 1179.83 g/mol |
| Exact Mass | 1179.08 |
| IUPAC Name | 1,6-bis[3,6-bis(2,3,4,5,6-pentafluorophenyl)carbazol-9-yl]-[1]benzothiolo[2,3-c]pyridine |
| SMILES | Fc1c(F)c(F)c(-c2ccc3c(c2)c2cc(-c4c(F)c(F)c(F)c(F)c4F)ccc2n3-c2ccc3sc4c(-n5c6ccc(-c7c(F)c(F)c(F)c(F)c7F)cc6c6cc(-c7c(F)c(F)c(F)c(F)c7F)ccc65)nccc4c3c2)c(F)c1F |
| InChI | InChI=1S/C59H17F20N3S/c60-38-34(39(61)47(69)54(76)46(38)68)18-1-6-29-24(13-18)25-14-19(35-40(62)48(70)55(77)49(71)41(35)63)2-7-30(25)81(29)22-5-10-33-28(17-22)23-11-12-80-59(58(23)83-33)82-31-8-3-20(36-42(64)50(72)56(78)51(73)43(36)65)15-26(31)27-16-21(4-9-32(27)82)37-44(66)52(74)57(79)53(75)45(37)67/h1-17H |
| InChIKey | AIDDAGUHIUYEQW-UHFFFAOYSA-N |
| XLogP | 19.09 |
| TPSA | 22.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 83 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1179.83 |
| LogP ≤ 5 | 19.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|