C18H21F2N3O5S — CID 129309012
2-[[2-[(E)-[cyano(phenyl)methylidene]amino]sulfonyl-2,2-difluoroacetyl]amino]ethyl 2,2-dimethylbutanoate (PubChem CID 129309012) has the molecular formula C18H21F2N3O5S and a molecular weight of 429.45 g/mol. Its IUPAC name is 2-[[2-[(E)-[cyano(phenyl)methylidene]amino]sulfonyl-2,2-difluoroacetyl]amino]ethyl 2,2-dimethylbutanoate.
| Compound Name | 2-[[2-[(E)-[cyano(phenyl)methylidene]amino]sulfonyl-2,2-difluoroacetyl]amino]ethyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 129309012 |
| Molecular Formula | C18H21F2N3O5S |
| Molecular Weight | 429.45 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | 2-[[2-[(E)-[cyano(phenyl)methylidene]amino]sulfonyl-2,2-difluoroacetyl]amino]ethyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCCNC(=O)C(F)(F)S(=O)(=O)/N=C(/C#N)c1ccccc1 |
| InChI | InChI=1S/C18H21F2N3O5S/c1-4-17(2,3)16(25)28-11-10-22-15(24)18(19,20)29(26,27)23-14(12-21)13-8-6-5-7-9-13/h5-9H,4,10-11H2,1-3H3,(H,22,24)/b23-14- |
| InChIKey | NHIOVFPUEDBFDJ-UCQKPKSFSA-N |
| XLogP | 2.02 |
| TPSA | 125.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.45 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|